Pigment Orange 16 – Corimax Orange BRN
Pigment Orange 16 is a bright, strong orange pigment widely used in coatings, inks, paints, and plastics. Known for its excellent lightfastness, weather resistance, and chemical stability, it delivers vibrant and long-lasting color, making it ideal for both indoor and outdoor applications. This pigment provides good opacity and color strength, ensuring a rich orange hue that maintains its vibrancy over time. Pigment Orange 16 is often chosen for industrial coatings, automotive finishes, and packaging, where durability and color consistency are essential. It is also valued for its non-toxic properties and environmental safety in various manufacturing sectors.
Technical parameters of Pigment orange 16
| Индекс боја бр. | Пигмент наранџасти 16 |
| Назив производа | Corimax Orange BRN |
| Производ Категорија | Органски Пигмент |
| ЦАС број | 3520-72-7 |
| ЕУ број | 222-530-3 |
| Породица хемикалија | Дисазо |
| Молекуларна тежина | 623.49 |
| Молекуларна формула | Ц32Х24ЦИ2Н8О2 |
| ПХ вредност | 7 |
| Густина | 1.5 |
| Апсорпција уља (мл / 100 г)% | 35 |
| Лагана брзина (премаз) | 5 |
| Отпорност на топлоту (премаз) | 180 |
| Брзина светлости (пластична) | 6 |
| Отпорност на топлину (пластика) | 200 |
| Отпорност на воду | 5 |
| Отпорност на уље | 4 |
| Отпорност на киселину | 4 |
| Отпорност на алкалије | 4 |
Боја | ![]() |
| Распрострањеност нијанси |
Апликација:
Recommended for powder coatings, printing pastes, PVC, rubber, PP, PE, offset inks, water-based inks, solvent inks
Предлаже се за ПС, ПУ, УВ мастила.
Сродне информације
There are 36 types of pigment commercial dosage forms, and they still have a certain market in Europe, America and Japan. It gives a yellowish orange color, which is significantly redder than the C.I. pigment orange 13 and pigment orange 34. Mainly used in printing inks, and can be used to adjust the color light of C.I. Pigment Yellow 12. Resinized formulations have high transparency, but poor fluidity. Due to their poor fastness properties, they are mostly used for packaging inks with high transparency and low cost.
Алиасес: 21160; C.I.Pigment Orange 16; P.O.16; Dianisidine Orange; 2,2'-[[3,3'-dimethyl(1,1'-biphenyl)-4,4'-diyl]bis(azo)]bis(3-oxo-N-phenyl-Butanamide]; 2,2'-[(3,3'-dimethoxybiphenyl-4,4'-diyl)di(E)diazene-2,1-diyl]bis(3-oxo-N-phenylbutanamide)
ИнЦхИ: InChI=1/C34H32N6O6/c1-21(41)31(33(43)35-25-11-7-5-8-12-25)39-37-27-17-15-23(19-29(27)45-3)24-16-18-28(30(20-24)46-4)38-40-32(22(2)42)34(44)36-26-13-9-6-10-14-26/h5-20,31-32H,1-4H3,(H,35,43)(H,36,44)/b39-37+,40-38+
Молекуларна структура:
Физичка и хемијска својства
Solubility: Do not dissolve in water and ethanol, dissolve in concentrated sulfuric acid, and show orange precipitate after dilution.
Hue or light: red light orange
Релативна густина: 1.28-1.51
Bulk density / (lb / gal): 10.6-12.5
pH value / (10% slurry): 5.0-7.5
Oil absorption / (g / 100g): 28-54
Снага прекривања: прозрачна
Structural Identifiers
IUPAC Name: 2,2'-[(3,3'-Dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(diazene-2,1-diyl)]bis(3-oxo-N-phenylbutanamide)
SMILES: COC1=CC(=CC=C1N=NC(C(C)=O)C(=O)NC1=CC=CC=C1)C1=CC(OC)=C(C=C1)N=NC(C(C)=O)C(=O)NC1=CC=CC=C1
InChI String: InChI=1/C34H32N6O6/c1-21(41)31(33(43)35-25-11-7-5-8-12-25)39-37-27-17-15-23(19-29(27)45-3)24-16-18-28(30(20-24)46-4)38-40-32(22(2)42)34(44)36-26-13-9-6-10-14-26/h5-20,31-32H,1-4H3,(H,35,43)(H,36,44)
InChIKey: DMPXHEMGDYKSFL-UHFFFAOYSA-N
Цомпутед Пропертиес
| Име имовине | Вредност имовине |
| Молекуларна тежина | 620.7 g/mol |
| КСЛогП3-АА | 6.7 |
| Број донатора водоничне везе | 2 |
| Број акцептора водоничне везе | 10 |
| Ротатабле Бонд Цоунт | 13 |
| Тачна маса | 620.23833276 Da |
| Моноисотопиц Масс | 620.23833276 Da |
| Тополошка поларна површина | 160 Ų |
| Број тешких атома | 46 |
| Формал Цхарге | 0 |
| Сложеност | 1000 |
| Број атома изотопа | 0 |
| Дефинисани број стереоцентра атома | 0 |
| Недефинисан број стереоцентра атома | 2 |
| Дефинисани број стереоцентра веза | 0 |
| Недефинисан број бонд стереоцентра | 0 |
| Број јединица ковалентно везаних | 1 |
| Спој је канонизован | да |











